C15H24FNO3 — CID 125451173
tert-butyl (5R,6R)-5-fluoro-7-oxa-3-azaspiro[5.6]dodec-9-ene-3-carboxylate (PubChem CID 125451173) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is tert-butyl (5R,6R)-5-fluoro-7-oxa-3-azaspiro[5.6]dodec-9-ene-3-carboxylate.
| Compound Name | tert-butyl (5R,6R)-5-fluoro-7-oxa-3-azaspiro[5.6]dodec-9-ene-3-carboxylate |
|---|---|
| PubChem CID | 125451173 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl (5R,6R)-5-fluoro-7-oxa-3-azaspiro[5.6]dodec-9-ene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]2(CCC=CCO2)[C@H](F)C1 |
| InChI | InChI=1S/C15H24FNO3/c1-14(2,3)20-13(18)17-9-8-15(12(16)11-17)7-5-4-6-10-19-15/h4,6,12H,5,7-11H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | ACAWQWSDPGYWIN-IUODEOHRSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|