C19H29F2NO3 — CID 142816360
tert-butyl 4-fluoro-4-[[(1Z,6Z)-1-fluoroocta-1,3,6-trien-2-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 142816360) has the molecular formula C19H29F2NO3 and a molecular weight of 357.44 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-[[(1Z,6Z)-1-fluoroocta-1,3,6-trien-2-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-[[(1Z,6Z)-1-fluoroocta-1,3,6-trien-2-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142816360 |
| Molecular Formula | C19H29F2NO3 |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | tert-butyl 4-fluoro-4-[[(1Z,6Z)-1-fluoroocta-1,3,6-trien-2-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | C/C=C\CC=C/C(=C/F)OCC1(F)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29F2NO3/c1-5-6-7-8-9-16(14-20)24-15-19(21)10-12-22(13-11-19)17(23)25-18(2,3)4/h5-6,8-9,14H,7,10-13,15H2,1-4H3/b6-5-,9-8?,16-14- |
| InChIKey | MVSDSXMRYRVPKE-TVZHDSILSA-N |
| XLogP | 5.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|