C10H13FO4 — CID 125453141
ethyl 2-[(1R,3R)-3-fluoro-2-oxocyclohexyl]-2-oxoacetate (PubChem CID 125453141) has the molecular formula C10H13FO4 and a molecular weight of 216.21 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-fluoro-2-oxocyclohexyl]-2-oxoacetate.
| Compound Name | ethyl 2-[(1R,3R)-3-fluoro-2-oxocyclohexyl]-2-oxoacetate |
|---|---|
| PubChem CID | 125453141 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-fluoro-2-oxocyclohexyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@H]1CCC[C@@H](F)C1=O |
| InChI | InChI=1S/C10H13FO4/c1-2-15-10(14)9(13)6-4-3-5-7(11)8(6)12/h6-7H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | LQGRBOSKDDYCAT-NKWVEPMBSA-N |
| XLogP | 0.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|