C10H10O6 — CID 98053578
ethyl 2-[(1S,3S)-3-methyl-2,4,5-trioxocyclopentyl]-2-oxoacetate (PubChem CID 98053578) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is ethyl 2-[(1S,3S)-3-methyl-2,4,5-trioxocyclopentyl]-2-oxoacetate.
| Compound Name | ethyl 2-[(1S,3S)-3-methyl-2,4,5-trioxocyclopentyl]-2-oxoacetate |
|---|---|
| PubChem CID | 98053578 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | ethyl 2-[(1S,3S)-3-methyl-2,4,5-trioxocyclopentyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@H]1C(=O)C(=O)[C@@H](C)C1=O |
| InChI | InChI=1S/C10H10O6/c1-3-16-10(15)9(14)5-6(11)4(2)7(12)8(5)13/h4-5H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | ZOZZQXRJOZKHSK-WHFBIAKZSA-N |
| XLogP | -0.91 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|