C17H24O6 — CID 98160624
ethyl 2-[(1S,3S)-3-octyl-2,4,5-trioxocyclopentyl]-2-oxoacetate (PubChem CID 98160624) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is ethyl 2-[(1S,3S)-3-octyl-2,4,5-trioxocyclopentyl]-2-oxoacetate.
| Compound Name | ethyl 2-[(1S,3S)-3-octyl-2,4,5-trioxocyclopentyl]-2-oxoacetate |
|---|---|
| PubChem CID | 98160624 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl 2-[(1S,3S)-3-octyl-2,4,5-trioxocyclopentyl]-2-oxoacetate |
| SMILES | CCCCCCCC[C@@H]1C(=O)C(=O)[C@@H](C(=O)C(=O)OCC)C1=O |
| InChI | InChI=1S/C17H24O6/c1-3-5-6-7-8-9-10-11-13(18)12(15(20)14(11)19)16(21)17(22)23-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | SUMZOGZJAVDREJ-RYUDHWBXSA-N |
| XLogP | 1.82 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|