C11H7F2NOS — CID 125454003
4-[2-(difluoromethyl)-1,3-thiazol-5-yl]benzaldehyde (PubChem CID 125454003) has the molecular formula C11H7F2NOS and a molecular weight of 239.25 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]benzaldehyde.
| Compound Name | 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 125454003 |
| Molecular Formula | C11H7F2NOS |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2cnc(C(F)F)s2)cc1 |
| InChI | InChI=1S/C11H7F2NOS/c12-10(13)11-14-5-9(16-11)8-3-1-7(6-15)2-4-8/h1-6,10H |
| InChIKey | QCBQGGWHSTZQTO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|