C15H14F3NOS — CID 164678856
6,6,6-trifluoro-1-phenyl-4-(1,3-thiazol-2-yl)hexan-1-one (PubChem CID 164678856) has the molecular formula C15H14F3NOS and a molecular weight of 313.34 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-phenyl-4-(1,3-thiazol-2-yl)hexan-1-one.
| Compound Name | 6,6,6-trifluoro-1-phenyl-4-(1,3-thiazol-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 164678856 |
| Molecular Formula | C15H14F3NOS |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 6,6,6-trifluoro-1-phenyl-4-(1,3-thiazol-2-yl)hexan-1-one |
| SMILES | O=C(CCC(CC(F)(F)F)c1nccs1)c1ccccc1 |
| InChI | InChI=1S/C15H14F3NOS/c16-15(17,18)10-12(14-19-8-9-21-14)6-7-13(20)11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10H2 |
| InChIKey | VGYWLWDCFCORHS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |