About phenyl(1,3-thiazol-2-yl)methanone
phenyl(1,3-thiazol-2-yl)methanone (PubChem CID 569967) has the molecular formula C10H7NOS
and a molecular weight of 189.24 g/mol. Its IUPAC name is phenyl(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | phenyl(1,3-thiazol-2-yl)methanone |
| PubChem CID | 569967 |
| Molecular Formula | C10H7NOS |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | phenyl(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C10H7NOS/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-7H |
| InChIKey | JLTSGRABZPTRMS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(1,3-thiazol-2-yl)methanone?
The IUPAC name of phenyl(1,3-thiazol-2-yl)methanone (CID 569967) is phenyl(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for phenyl(1,3-thiazol-2-yl)methanone?
The canonical SMILES for phenyl(1,3-thiazol-2-yl)methanone is O=C(c1ccccc1)c1nccs1.
What is the InChIKey of phenyl(1,3-thiazol-2-yl)methanone?
The InChIKey is JLTSGRABZPTRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NOS/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-7H.
What are the key properties of phenyl(1,3-thiazol-2-yl)methanone?
phenyl(1,3-thiazol-2-yl)methanone has a molecular weight of 189.24 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 569967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).