C13H14BrNOS — CID 13212728
2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide (PubChem CID 13212728) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide |
|---|---|
| PubChem CID | 13212728 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide |
| SMILES | Cc1csc(C)[n+]1CC(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C13H14NOS.BrH/c1-10-9-16-11(2)14(10)8-13(15)12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GHWIEACTBNWNCZ-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|