C17H29NO3 — CID 125454938
tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-propan-2-ylcyclopropyl]piperidine-1-carboxylate (PubChem CID 125454938) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-propan-2-ylcyclopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-propan-2-ylcyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 125454938 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-propan-2-ylcyclopropyl]piperidine-1-carboxylate |
| SMILES | CC(C)[C@@H]1[C@H](C=O)[C@H]1[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H29NO3/c1-11(2)14-13(10-19)15(14)12-7-6-8-18(9-12)16(20)21-17(3,4)5/h10-15H,6-9H2,1-5H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | ZDFWEZFWAIVZAW-LXTVHRRPSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|