C15H25NO3 — CID 125454640
tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-methylcyclopropyl]piperidine-1-carboxylate (PubChem CID 125454640) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-methylcyclopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-methylcyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 125454640 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl (3S)-3-[(1R,2S,3S)-2-formyl-3-methylcyclopropyl]piperidine-1-carboxylate |
| SMILES | C[C@@H]1[C@H](C=O)[C@H]1[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25NO3/c1-10-12(9-17)13(10)11-6-5-7-16(8-11)14(18)19-15(2,3)4/h9-13H,5-8H2,1-4H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | WXADLARSPKPTBW-FVCCEPFGSA-N |
| XLogP | 2.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|