C12H19Br2NO2 — CID 86615128
tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate (PubChem CID 86615128) has the molecular formula C12H19Br2NO2 and a molecular weight of 369.10 g/mol. Its IUPAC name is tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86615128 |
| Molecular Formula | C12H19Br2NO2 |
| Molecular Weight | 369.10 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C=C(Br)Br)C1 |
| InChI | InChI=1S/C12H19Br2NO2/c1-12(2,3)17-11(16)15-6-4-5-9(8-15)7-10(13)14/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | JLLHQGDVSWDHAL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.10 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |