C12H20N2O4 — CID 156595712
tert-butyl 3-[(E)-2-nitroethenyl]piperidine-1-carboxylate (PubChem CID 156595712) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl 3-[(E)-2-nitroethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-2-nitroethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156595712 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl 3-[(E)-2-nitroethenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(/C=C/[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H20N2O4/c1-12(2,3)18-11(15)13-7-4-5-10(9-13)6-8-14(16)17/h6,8,10H,4-5,7,9H2,1-3H3/b8-6+ |
| InChIKey | IEWSHPFMIMUZSI-SOFGYWHQSA-N |
| XLogP | 2.42 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|