About 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole
2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole (PubChem CID 125455900) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole |
| PubChem CID | 125455900 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole |
| SMILES | CC1(Cc2ncc[nH]2)OCCO1 |
| InChI | InChI=1S/C8H12N2O2/c1-8(11-4-5-12-8)6-7-9-2-3-10-7/h2-3H,4-6H2,1H3,(H,9,10) |
| InChIKey | LIAAIOMJCMXDMY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole?
The IUPAC name of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole (CID 125455900) is 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole.
What is the SMILES notation for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole?
The canonical SMILES for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole is CC1(Cc2ncc[nH]2)OCCO1.
What is the InChIKey of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole?
The InChIKey is LIAAIOMJCMXDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-8(11-4-5-12-8)6-7-9-2-3-10-7/h2-3H,4-6H2,1H3,(H,9,10).
What are the key properties of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole?
2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole has a molecular weight of 168.20 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]-1H-imidazole is sourced from PubChem (CID 125455900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).