C13H18N7+ — CID 18690534
tris(1H-imidazol-2-ylmethyl)-methylazanium (PubChem CID 18690534) has the molecular formula C13H18N7+ and a molecular weight of 272.34 g/mol. Its IUPAC name is tris(1H-imidazol-2-ylmethyl)-methylazanium.
| Compound Name | tris(1H-imidazol-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 18690534 |
| Molecular Formula | C13H18N7+ |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | tris(1H-imidazol-2-ylmethyl)-methylazanium |
| SMILES | C[N+](Cc1ncc[nH]1)(Cc1ncc[nH]1)Cc1ncc[nH]1 |
| InChI | InChI=1S/C13H18N7/c1-20(8-11-14-2-3-15-11,9-12-16-4-5-17-12)10-13-18-6-7-19-13/h2-7H,8-10H2,1H3,(H,14,15)(H,16,17)(H,18,19)/q+1 |
| InChIKey | OQQYLRWFTHUDSU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|