C12H10F6N2 — CID 125457020
2-[2,5-bis(trifluoromethyl)-1H-indol-3-yl]ethanamine (PubChem CID 125457020) has the molecular formula C12H10F6N2 and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)-1H-indol-3-yl]ethanamine.
| Compound Name | 2-[2,5-bis(trifluoromethyl)-1H-indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 125457020 |
| Molecular Formula | C12H10F6N2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)-1H-indol-3-yl]ethanamine |
| SMILES | NCCc1c(C(F)(F)F)[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H10F6N2/c13-11(14,15)6-1-2-9-8(5-6)7(3-4-19)10(20-9)12(16,17)18/h1-2,5,20H,3-4,19H2 |
| InChIKey | IFSINHLCRDSPHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |