C11H4ClF6NO — CID 18476333
2,5-bis(trifluoromethyl)-1H-indole-3-carbonyl chloride (PubChem CID 18476333) has the molecular formula C11H4ClF6NO and a molecular weight of 315.60 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)-1H-indole-3-carbonyl chloride.
| Compound Name | 2,5-bis(trifluoromethyl)-1H-indole-3-carbonyl chloride |
|---|---|
| PubChem CID | 18476333 |
| Molecular Formula | C11H4ClF6NO |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2,5-bis(trifluoromethyl)-1H-indole-3-carbonyl chloride |
| SMILES | O=C(Cl)c1c(C(F)(F)F)[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C11H4ClF6NO/c12-9(20)7-5-3-4(10(13,14)15)1-2-6(5)19-8(7)11(16,17)18/h1-3,19H |
| InChIKey | MENPFFJSLNDMTI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|