C15H7F6NO — CID 177468956
3,6-bis(trifluoromethyl)-9H-carbazole-1-carbaldehyde (PubChem CID 177468956) has the molecular formula C15H7F6NO and a molecular weight of 331.22 g/mol. Its IUPAC name is 3,6-bis(trifluoromethyl)-9H-carbazole-1-carbaldehyde.
| Compound Name | 3,6-bis(trifluoromethyl)-9H-carbazole-1-carbaldehyde |
|---|---|
| PubChem CID | 177468956 |
| Molecular Formula | C15H7F6NO |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3,6-bis(trifluoromethyl)-9H-carbazole-1-carbaldehyde |
| SMILES | O=Cc1cc(C(F)(F)F)cc2c1[nH]c1ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C15H7F6NO/c16-14(17,18)8-1-2-12-10(4-8)11-5-9(15(19,20)21)3-7(6-23)13(11)22-12/h1-6,22H |
| InChIKey | RSICQBQLACQVQZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|