C10H14F2N4O — CID 125457943
N-(2,2-difluoroethyl)-1-[1-[[(3R)-oxolan-3-yl]methyl]triazol-4-yl]methanimine (PubChem CID 125457943) has the molecular formula C10H14F2N4O and a molecular weight of 244.24 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-[1-[[(3R)-oxolan-3-yl]methyl]triazol-4-yl]methanimine.
| Compound Name | N-(2,2-difluoroethyl)-1-[1-[[(3R)-oxolan-3-yl]methyl]triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 125457943 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-[1-[[(3R)-oxolan-3-yl]methyl]triazol-4-yl]methanimine |
| SMILES | FC(F)C/N=C/c1cn(C[C@H]2CCOC2)nn1 |
| InChI | InChI=1S/C10H14F2N4O/c11-10(12)4-13-3-9-6-16(15-14-9)5-8-1-2-17-7-8/h3,6,8,10H,1-2,4-5,7H2/b13-3+/t8-/m1/s1 |
| InChIKey | RVOSKHYEAAPPFI-BOYFAHNTSA-N |
| XLogP | 1.00 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|