C16H23NO2 — CID 125458660
[(2R,3aS,7aR)-5-benzyl-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methanol (PubChem CID 125458660) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is [(2R,3aS,7aR)-5-benzyl-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methanol.
| Compound Name | [(2R,3aS,7aR)-5-benzyl-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methanol |
|---|---|
| PubChem CID | 125458660 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | [(2R,3aS,7aR)-5-benzyl-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methanol |
| SMILES | C[C@@H]1C[C@@]2(CO)CN(Cc3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C16H23NO2/c1-13-9-16(12-18)11-17(8-7-15(16)19-13)10-14-5-3-2-4-6-14/h2-6,13,15,18H,7-12H2,1H3/t13-,15-,16+/m1/s1 |
| InChIKey | VGBCYGHICHZLQC-BMFZPTHFSA-N |
| XLogP | 2.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |