C16H22BrNO — CID 125458785
(2R,3aS,7aS)-5-benzyl-3a-(bromomethyl)-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine (PubChem CID 125458785) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is (2R,3aS,7aS)-5-benzyl-3a-(bromomethyl)-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine.
| Compound Name | (2R,3aS,7aS)-5-benzyl-3a-(bromomethyl)-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 125458785 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2R,3aS,7aS)-5-benzyl-3a-(bromomethyl)-2-methyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
| SMILES | C[C@@H]1C[C@]2(CBr)CN(Cc3ccccc3)CC[C@@H]2O1 |
| InChI | InChI=1S/C16H22BrNO/c1-13-9-16(11-17)12-18(8-7-15(16)19-13)10-14-5-3-2-4-6-14/h2-6,13,15H,7-12H2,1H3/t13-,15+,16+/m1/s1 |
| InChIKey | WWLGXDWHVFXAPZ-KBMXLJTQSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|