C15H19N3O5S — CID 125463969
[1-[6-[(1S)-1-acetamidoethyl]-1,3-benzoxazol-2-yl]azetidin-3-yl] methanesulfonate (PubChem CID 125463969) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is [1-[6-[(1S)-1-acetamidoethyl]-1,3-benzoxazol-2-yl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[6-[(1S)-1-acetamidoethyl]-1,3-benzoxazol-2-yl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 125463969 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [1-[6-[(1S)-1-acetamidoethyl]-1,3-benzoxazol-2-yl]azetidin-3-yl] methanesulfonate |
| SMILES | CC(=O)N[C@@H](C)c1ccc2nc(N3CC(OS(C)(=O)=O)C3)oc2c1 |
| InChI | InChI=1S/C15H19N3O5S/c1-9(16-10(2)19)11-4-5-13-14(6-11)22-15(17-13)18-7-12(8-18)23-24(3,20)21/h4-6,9,12H,7-8H2,1-3H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | RQTNERNOANSHNM-VIFPVBQESA-N |
| XLogP | 1.19 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|