C12H14N2O2S — CID 130472766
N-[1-(2-methylsulfanyl-1,3-benzoxazol-6-yl)ethyl]acetamide (PubChem CID 130472766) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[1-(2-methylsulfanyl-1,3-benzoxazol-6-yl)ethyl]acetamide.
| Compound Name | N-[1-(2-methylsulfanyl-1,3-benzoxazol-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 130472766 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[1-(2-methylsulfanyl-1,3-benzoxazol-6-yl)ethyl]acetamide |
| SMILES | CSc1nc2ccc(C(C)NC(C)=O)cc2o1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7(13-8(2)15)9-4-5-10-11(6-9)16-12(14-10)17-3/h4-7H,1-3H3,(H,13,15) |
| InChIKey | QHQTVWKCLOWNHH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |