C15H20O3S — CID 125464157
2-[(1S,2R)-2-(4-methoxyphenyl)cyclohexyl]sulfanylacetic acid (PubChem CID 125464157) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(4-methoxyphenyl)cyclohexyl]sulfanylacetic acid.
| Compound Name | 2-[(1S,2R)-2-(4-methoxyphenyl)cyclohexyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 125464157 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[(1S,2R)-2-(4-methoxyphenyl)cyclohexyl]sulfanylacetic acid |
| SMILES | COc1ccc([C@H]2CCCC[C@@H]2SCC(=O)O)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-18-12-8-6-11(7-9-12)13-4-2-3-5-14(13)19-10-15(16)17/h6-9,13-14H,2-5,10H2,1H3,(H,16,17)/t13-,14+/m1/s1 |
| InChIKey | NBGPYCWQZALPNK-KGLIPLIRSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |