C16H22O3S2 — CID 19000435
methyl 2-[2-(4-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetate (PubChem CID 19000435) has the molecular formula C16H22O3S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is methyl 2-[2-(4-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetate.
| Compound Name | methyl 2-[2-(4-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 19000435 |
| Molecular Formula | C16H22O3S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 2-[2-(4-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetate |
| SMILES | COC(=O)CSC1CCCCC1Sc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22O3S2/c1-18-12-7-9-13(10-8-12)21-15-6-4-3-5-14(15)20-11-16(17)19-2/h7-10,14-15H,3-6,11H2,1-2H3 |
| InChIKey | UHLHYRDZXNQVQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |