C18H27NO3S2 — CID 54274321
N-(2-methoxyethyl)-2-[(1R,2R)-2-(3-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetamide (PubChem CID 54274321) has the molecular formula C18H27NO3S2 and a molecular weight of 369.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(1R,2R)-2-(3-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetamide.
| Compound Name | N-(2-methoxyethyl)-2-[(1R,2R)-2-(3-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetamide |
|---|---|
| PubChem CID | 54274321 |
| Molecular Formula | C18H27NO3S2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(1R,2R)-2-(3-methoxyphenyl)sulfanylcyclohexyl]sulfanylacetamide |
| SMILES | COCCNC(=O)CS[C@@H]1CCCC[C@H]1Sc1cccc(OC)c1 |
| InChI | InChI=1S/C18H27NO3S2/c1-21-11-10-19-18(20)13-23-16-8-3-4-9-17(16)24-15-7-5-6-14(12-15)22-2/h5-7,12,16-17H,3-4,8-11,13H2,1-2H3,(H,19,20)/t16-,17-/m1/s1 |
| InChIKey | RMIRTJVYEUOLIE-IAGOWNOFSA-N |
| XLogP | 3.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|