C10H11FN2O2 — CID 125464520
(2S,3S)-3-fluoro-2-[(2-nitrophenyl)methyl]azetidine (PubChem CID 125464520) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is (2S,3S)-3-fluoro-2-[(2-nitrophenyl)methyl]azetidine.
| Compound Name | (2S,3S)-3-fluoro-2-[(2-nitrophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 125464520 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2S,3S)-3-fluoro-2-[(2-nitrophenyl)methyl]azetidine |
| SMILES | O=[N+]([O-])c1ccccc1C[C@@H]1NC[C@@H]1F |
| InChI | InChI=1S/C10H11FN2O2/c11-8-6-12-9(8)5-7-3-1-2-4-10(7)13(14)15/h1-4,8-9,12H,5-6H2/t8-,9-/m0/s1 |
| InChIKey | OMIDSGIYRHTSAP-IUCAKERBSA-N |
| XLogP | 1.45 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|