C24H26N2O3 — CID 125464627
2,6-dimethoxy-N-[(1R,2R)-2-(quinolin-2-ylmethyl)cyclopentyl]benzamide (PubChem CID 125464627) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(1R,2R)-2-(quinolin-2-ylmethyl)cyclopentyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[(1R,2R)-2-(quinolin-2-ylmethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 125464627 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2,6-dimethoxy-N-[(1R,2R)-2-(quinolin-2-ylmethyl)cyclopentyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1CCC[C@@H]1Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H26N2O3/c1-28-21-11-6-12-22(29-2)23(21)24(27)26-20-10-5-8-17(20)15-18-14-13-16-7-3-4-9-19(16)25-18/h3-4,6-7,9,11-14,17,20H,5,8,10,15H2,1-2H3,(H,26,27)/t17-,20-/m1/s1 |
| InChIKey | BEAWQNXRRFJSHK-YLJYHZDGSA-N |
| XLogP | 4.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |