C15H10Cl3F2NO — CID 125464994
2-chloro-N-[2-(2,4-dichlorophenyl)-2,2-difluoroethyl]benzamide (PubChem CID 125464994) has the molecular formula C15H10Cl3F2NO and a molecular weight of 364.61 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dichlorophenyl)-2,2-difluoroethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(2,4-dichlorophenyl)-2,2-difluoroethyl]benzamide |
|---|---|
| PubChem CID | 125464994 |
| Molecular Formula | C15H10Cl3F2NO |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dichlorophenyl)-2,2-difluoroethyl]benzamide |
| SMILES | O=C(NCC(F)(F)c1ccc(Cl)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H10Cl3F2NO/c16-9-5-6-11(13(18)7-9)15(19,20)8-21-14(22)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,21,22) |
| InChIKey | OQRYPONIJFXCNY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |