C20H26FNO2 — CID 125466306
(1S)-N-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-1-phenylethanamine (PubChem CID 125466306) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is (1S)-N-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-1-phenylethanamine.
| Compound Name | (1S)-N-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 125466306 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1S)-N-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-1-phenylethanamine |
| SMILES | CCOC(CN[C@@H](Cc1ccc(F)cc1)c1ccccc1)OCC |
| InChI | InChI=1S/C20H26FNO2/c1-3-23-20(24-4-2)15-22-19(17-8-6-5-7-9-17)14-16-10-12-18(21)13-11-16/h5-13,19-20,22H,3-4,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | JTDKXPNXRWQFLR-IBGZPJMESA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|