C18H29NO4 — CID 125466683
N-[(R)-cyclopropyl-(3,4-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine (PubChem CID 125466683) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is N-[(R)-cyclopropyl-(3,4-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(R)-cyclopropyl-(3,4-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 125466683 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[(R)-cyclopropyl-(3,4-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CN[C@@H](c1ccc(OC)c(OC)c1)C1CC1)OCC |
| InChI | InChI=1S/C18H29NO4/c1-5-22-17(23-6-2)12-19-18(13-7-8-13)14-9-10-15(20-3)16(11-14)21-4/h9-11,13,17-19H,5-8,12H2,1-4H3/t18-/m1/s1 |
| InChIKey | IPLXBMSGWPXOQW-GOSISDBHSA-N |
| XLogP | 3.14 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|