C20H24N2O2 — CID 125466918
ethyl (2S)-2,4-dicyano-2-(4-cyclohexylphenyl)butanoate (PubChem CID 125466918) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl (2S)-2,4-dicyano-2-(4-cyclohexylphenyl)butanoate.
| Compound Name | ethyl (2S)-2,4-dicyano-2-(4-cyclohexylphenyl)butanoate |
|---|---|
| PubChem CID | 125466918 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | ethyl (2S)-2,4-dicyano-2-(4-cyclohexylphenyl)butanoate |
| SMILES | CCOC(=O)[C@@](C#N)(CCC#N)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-24-19(23)20(15-22,13-6-14-21)18-11-9-17(10-12-18)16-7-4-3-5-8-16/h9-12,16H,2-8,13H2,1H3/t20-/m1/s1 |
| InChIKey | VGFNHVGWBLPCPN-HXUWFJFHSA-N |
| XLogP | 4.36 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |