C17H17NO3 — CID 125468209
methyl 2-[(3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-ynyl]benzoate (PubChem CID 125468209) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 2-[(3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-ynyl]benzoate.
| Compound Name | methyl 2-[(3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-ynyl]benzoate |
|---|---|
| PubChem CID | 125468209 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 2-[(3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccccc1C#C[C@](C)(O)C1(C#N)CCC1 |
| InChI | InChI=1S/C17H17NO3/c1-16(20,17(12-18)9-5-10-17)11-8-13-6-3-4-7-14(13)15(19)21-2/h3-4,6-7,20H,5,9-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | DDSHUWYIXKDYOE-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|