C17H17NO4 — CID 125468469
2-[(3S)-3-(3-cyanooxetan-3-yl)-3-hydroxy-4-methylpent-1-ynyl]benzoic acid (PubChem CID 125468469) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[(3S)-3-(3-cyanooxetan-3-yl)-3-hydroxy-4-methylpent-1-ynyl]benzoic acid.
| Compound Name | 2-[(3S)-3-(3-cyanooxetan-3-yl)-3-hydroxy-4-methylpent-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 125468469 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(3S)-3-(3-cyanooxetan-3-yl)-3-hydroxy-4-methylpent-1-ynyl]benzoic acid |
| SMILES | CC(C)[C@](O)(C#Cc1ccccc1C(=O)O)C1(C#N)COC1 |
| InChI | InChI=1S/C17H17NO4/c1-12(2)17(21,16(9-18)10-22-11-16)8-7-13-5-3-4-6-14(13)15(19)20/h3-6,12,21H,10-11H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | VQTFEDMEZFUBDO-QGZVFWFLSA-N |
| XLogP | 1.66 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|