C20H15NO3 — CID 125468810
4-[(3R)-3-(1-cyanocyclopropyl)-3-hydroxy-3-phenylprop-1-ynyl]benzoic acid (PubChem CID 125468810) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[(3R)-3-(1-cyanocyclopropyl)-3-hydroxy-3-phenylprop-1-ynyl]benzoic acid.
| Compound Name | 4-[(3R)-3-(1-cyanocyclopropyl)-3-hydroxy-3-phenylprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 125468810 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-[(3R)-3-(1-cyanocyclopropyl)-3-hydroxy-3-phenylprop-1-ynyl]benzoic acid |
| SMILES | N#CC1([C@](O)(C#Cc2ccc(C(=O)O)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H15NO3/c21-14-19(12-13-19)20(24,17-4-2-1-3-5-17)11-10-15-6-8-16(9-7-15)18(22)23/h1-9,24H,12-13H2,(H,22,23)/t20-/m0/s1 |
| InChIKey | JKFNNOJOLARSPF-FQEVSTJZSA-N |
| XLogP | 2.93 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|