C17H15NO3 — CID 125468788
4-[(3R)-3-(1-cyanocyclopropyl)-3-cyclopropyl-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 125468788) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[(3R)-3-(1-cyanocyclopropyl)-3-cyclopropyl-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[(3R)-3-(1-cyanocyclopropyl)-3-cyclopropyl-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 125468788 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-[(3R)-3-(1-cyanocyclopropyl)-3-cyclopropyl-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | N#CC1([C@](O)(C#Cc2ccc(C(=O)O)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C17H15NO3/c18-11-16(9-10-16)17(21,14-5-6-14)8-7-12-1-3-13(4-2-12)15(19)20/h1-4,14,21H,5-6,9-10H2,(H,19,20)/t17-/m0/s1 |
| InChIKey | HZLDQLUBHSGBGF-KRWDZBQOSA-N |
| XLogP | 2.18 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|