C19H23NO3 — CID 125468780
4-[(E,3S)-3-(1-cyanocyclopropyl)-4-ethyl-3-hydroxyhex-1-enyl]benzoic acid (PubChem CID 125468780) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[(E,3S)-3-(1-cyanocyclopropyl)-4-ethyl-3-hydroxyhex-1-enyl]benzoic acid.
| Compound Name | 4-[(E,3S)-3-(1-cyanocyclopropyl)-4-ethyl-3-hydroxyhex-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 125468780 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[(E,3S)-3-(1-cyanocyclopropyl)-4-ethyl-3-hydroxyhex-1-enyl]benzoic acid |
| SMILES | CCC(CC)[C@](O)(/C=C/c1ccc(C(=O)O)cc1)C1(C#N)CC1 |
| InChI | InChI=1S/C19H23NO3/c1-3-16(4-2)19(23,18(13-20)11-12-18)10-9-14-5-7-15(8-6-14)17(21)22/h5-10,16,23H,3-4,11-12H2,1-2H3,(H,21,22)/b10-9+/t19-/m1/s1 |
| InChIKey | MNGSEHRXMJFEFL-JBVUFVISSA-N |
| XLogP | 3.87 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |