C19H19NO4 — CID 125468598
3-[(3R)-3-acetyloxy-3-(1-cyanocyclopropyl)-4-methylpent-1-ynyl]benzoic acid (PubChem CID 125468598) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-[(3R)-3-acetyloxy-3-(1-cyanocyclopropyl)-4-methylpent-1-ynyl]benzoic acid.
| Compound Name | 3-[(3R)-3-acetyloxy-3-(1-cyanocyclopropyl)-4-methylpent-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 125468598 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-[(3R)-3-acetyloxy-3-(1-cyanocyclopropyl)-4-methylpent-1-ynyl]benzoic acid |
| SMILES | CC(=O)O[C@@](C#Cc1cccc(C(=O)O)c1)(C(C)C)C1(C#N)CC1 |
| InChI | InChI=1S/C19H19NO4/c1-13(2)19(24-14(3)21,18(12-20)9-10-18)8-7-15-5-4-6-16(11-15)17(22)23/h4-6,11,13H,9-10H2,1-3H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | KADWXZDSTYLPMT-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|