C18H17NO3 — CID 125468892
4-[(3S)-3-(1-cyanocyclopropyl)-3-cyclobutyl-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 125468892) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[(3S)-3-(1-cyanocyclopropyl)-3-cyclobutyl-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[(3S)-3-(1-cyanocyclopropyl)-3-cyclobutyl-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 125468892 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-[(3S)-3-(1-cyanocyclopropyl)-3-cyclobutyl-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | N#CC1([C@@](O)(C#Cc2ccc(C(=O)O)cc2)C2CCC2)CC1 |
| InChI | InChI=1S/C18H17NO3/c19-12-17(10-11-17)18(22,15-2-1-3-15)9-8-13-4-6-14(7-5-13)16(20)21/h4-7,15,22H,1-3,10-11H2,(H,20,21)/t18-/m1/s1 |
| InChIKey | RGWSTTWFXJSRSQ-GOSISDBHSA-N |
| XLogP | 2.57 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|