C8H15F2N — CID 125470812
[(1S,3R)-4,4-difluoro-3-methylcyclohexyl]methanamine (PubChem CID 125470812) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is [(1S,3R)-4,4-difluoro-3-methylcyclohexyl]methanamine.
| Compound Name | [(1S,3R)-4,4-difluoro-3-methylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 125470812 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | [(1S,3R)-4,4-difluoro-3-methylcyclohexyl]methanamine |
| SMILES | C[C@@H]1C[C@@H](CN)CCC1(F)F |
| InChI | InChI=1S/C8H15F2N/c1-6-4-7(5-11)2-3-8(6,9)10/h6-7H,2-5,11H2,1H3/t6-,7+/m1/s1 |
| InChIKey | WYASQTMLLITJCF-RQJHMYQMSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |