C20H28O4 — CID 125470846
[(1S,2S,3S,5S,8S,11R,12S,15S,16S)-16-methyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-15-yl] acetate (PubChem CID 125470846) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1S,2S,3S,5S,8S,11R,12S,15S,16S)-16-methyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-15-yl] acetate.
| Compound Name | [(1S,2S,3S,5S,8S,11R,12S,15S,16S)-16-methyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-15-yl] acetate |
|---|---|
| PubChem CID | 125470846 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1S,2S,3S,5S,8S,11R,12S,15S,16S)-16-methyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-15-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)[C@H]5O[C@H]5[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28O4/c1-10(21)23-16-6-5-14-12-4-3-11-9-15(22)18-19(24-18)17(11)13(12)7-8-20(14,16)2/h11-14,16-19H,3-9H2,1-2H3/t11-,12+,13-,14-,16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | AIBWKRQCCPDKAO-JVPPIQOUSA-N |
| XLogP | 3.13 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|