C19H25ClO — CID 125471500
(8S,9S,13S,14S,17S)-1-chloro-4,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 125471500) has the molecular formula C19H25ClO and a molecular weight of 304.86 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-1-chloro-4,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,13S,14S,17S)-1-chloro-4,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 125471500 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (8S,9S,13S,14S,17S)-1-chloro-4,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1ccc(Cl)c2c1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C19H25ClO/c1-11-3-7-16(20)18-12(11)4-5-13-14(18)9-10-19(2)15(13)6-8-17(19)21/h3,7,13-15,17,21H,4-6,8-10H2,1-2H3/t13-,14+,15+,17+,19+/m1/s1 |
| InChIKey | IDJMTIZMJQTEBS-BTWZCHHXSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |