C14H13NO — CID 125472369
1-[(1R)-1-hydroxy-1-(4-methylphenyl)prop-2-ynyl]cyclopropane-1-carbonitrile (PubChem CID 125472369) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[(1R)-1-hydroxy-1-(4-methylphenyl)prop-2-ynyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[(1R)-1-hydroxy-1-(4-methylphenyl)prop-2-ynyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 125472369 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-[(1R)-1-hydroxy-1-(4-methylphenyl)prop-2-ynyl]cyclopropane-1-carbonitrile |
| SMILES | C#C[C@@](O)(c1ccc(C)cc1)C1(C#N)CC1 |
| InChI | InChI=1S/C14H13NO/c1-3-14(16,13(10-15)8-9-13)12-6-4-11(2)5-7-12/h1,4-7,16H,8-9H2,2H3/t14-/m1/s1 |
| InChIKey | VVACGKMVZGSQFM-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|