C5H12N2O2S — CID 125472370
cis-(1S,3R)-3-aminocyclopentane-1-sulfonamide (PubChem CID 125472370) has the molecular formula C5H12N2O2S and a molecular weight of 164.23 g/mol. Its IUPAC name is cis-(1S,3R)-3-aminocyclopentane-1-sulfonamide.
| Compound Name | cis-(1S,3R)-3-aminocyclopentane-1-sulfonamide |
|---|---|
| PubChem CID | 125472370 |
| Molecular Formula | C5H12N2O2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | cis-(1S,3R)-3-aminocyclopentane-1-sulfonamide |
| SMILES | N[C@@H]1CC[C@H](S(N)(=O)=O)C1 |
| InChI | InChI=1S/C5H12N2O2S/c6-4-1-2-5(3-4)10(7,8)9/h4-5H,1-3,6H2,(H2,7,8,9)/t4-,5+/m1/s1 |
| InChIKey | VVZDCQJUDFSIKU-UHNVWZDZSA-N |
| XLogP | -0.85 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |