C11H14FNO2S — CID 64724253
3-(4-fluorophenyl)sulfonylcyclopentan-1-amine (PubChem CID 64724253) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonylcyclopentan-1-amine.
| Compound Name | 3-(4-fluorophenyl)sulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64724253 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonylcyclopentan-1-amine |
| SMILES | NC1CCC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H14FNO2S/c12-8-1-4-10(5-2-8)16(14,15)11-6-3-9(13)7-11/h1-2,4-5,9,11H,3,6-7,13H2 |
| InChIKey | GAVOMOBYCQGYMW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |