C16H22FNO4S2 — CID 144881858
4-[4-(4-fluorophenyl)sulfonylcyclohexyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 144881858) has the molecular formula C16H22FNO4S2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)sulfonylcyclohexyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-(4-fluorophenyl)sulfonylcyclohexyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 144881858 |
| Molecular Formula | C16H22FNO4S2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-[4-(4-fluorophenyl)sulfonylcyclohexyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(C2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C16H22FNO4S2/c17-13-1-5-15(6-2-13)24(21,22)16-7-3-14(4-8-16)18-9-11-23(19,20)12-10-18/h1-2,5-6,14,16H,3-4,7-12H2 |
| InChIKey | PHRSSNKBTODCFK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |