C21H25NO2 — CID 125474210
(3R)-3-tert-butyl-7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline (PubChem CID 125474210) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (3R)-3-tert-butyl-7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline.
| Compound Name | (3R)-3-tert-butyl-7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 125474210 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (3R)-3-tert-butyl-7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OCc1ccccc1)C[C@H](C(C)(C)C)N=C2 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,3)20-12-16-10-19(18(23-4)11-17(16)13-22-20)24-14-15-8-6-5-7-9-15/h5-11,13,20H,12,14H2,1-4H3/t20-/m1/s1 |
| InChIKey | NCUNTMKMPAEJOE-HXUWFJFHSA-N |
| XLogP | 4.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |