C23H29NO3 — CID 138672844
6-(3-methoxypropoxy)-7-phenylmethoxy-3-propan-2-yl-3,4-dihydroisoquinoline (PubChem CID 138672844) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 6-(3-methoxypropoxy)-7-phenylmethoxy-3-propan-2-yl-3,4-dihydroisoquinoline.
| Compound Name | 6-(3-methoxypropoxy)-7-phenylmethoxy-3-propan-2-yl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 138672844 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 6-(3-methoxypropoxy)-7-phenylmethoxy-3-propan-2-yl-3,4-dihydroisoquinoline |
| SMILES | COCCCOc1cc2c(cc1OCc1ccccc1)C=NC(C(C)C)C2 |
| InChI | InChI=1S/C23H29NO3/c1-17(2)21-12-19-13-22(26-11-7-10-25-3)23(14-20(19)15-24-21)27-16-18-8-5-4-6-9-18/h4-6,8-9,13-15,17,21H,7,10-12,16H2,1-3H3 |
| InChIKey | GTGGNWANAXJURR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|