C10H18O4 — CID 125475030
(1S,4S,5R)-3,3-dihydroperoxy-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexane (PubChem CID 125475030) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S,4S,5R)-3,3-dihydroperoxy-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexane.
| Compound Name | (1S,4S,5R)-3,3-dihydroperoxy-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 125475030 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1S,4S,5R)-3,3-dihydroperoxy-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexane |
| SMILES | CC(C)[C@@]12C[C@@H]1[C@H](C)C(OO)(OO)C2 |
| InChI | InChI=1S/C10H18O4/c1-6(2)9-4-8(9)7(3)10(5-9,13-11)14-12/h6-8,11-12H,4-5H2,1-3H3/t7-,8+,9-/m0/s1 |
| InChIKey | QFGFHEQHRIMBTR-YIZRAAEISA-N |
| XLogP | 2.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|