C12H9Cl3N2O3 — CID 125476196
(4S)-4-[(E)-2-(3-nitrophenyl)ethenyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 125476196) has the molecular formula C12H9Cl3N2O3 and a molecular weight of 335.57 g/mol. Its IUPAC name is (4S)-4-[(E)-2-(3-nitrophenyl)ethenyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-[(E)-2-(3-nitrophenyl)ethenyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 125476196 |
| Molecular Formula | C12H9Cl3N2O3 |
| Molecular Weight | 335.57 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | (4S)-4-[(E)-2-(3-nitrophenyl)ethenyl]-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | O=[N+]([O-])c1cccc(/C=C/[C@H]2COC(C(Cl)(Cl)Cl)=N2)c1 |
| InChI | InChI=1S/C12H9Cl3N2O3/c13-12(14,15)11-16-9(7-20-11)5-4-8-2-1-3-10(6-8)17(18)19/h1-6,9H,7H2/b5-4+/t9-/m0/s1 |
| InChIKey | IWCYSPBGSBYZIG-MOVJSRMASA-N |
| XLogP | 3.78 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|